About benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate
benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate (PubChem CID 68674346) has the molecular formula C19H21NO5
and a molecular weight of 343.38 g/mol. Its IUPAC name is benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate |
| PubChem CID | 68674346 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate |
| SMILES | C=C(CC=CC#N)C(=O)OCc1ccccc1.C=CC(=O)OCCO |
| InChI | InChI=1S/C14H13NO2.C5H8O3/c1-12(7-5-6-10-15)14(16)17-11-13-8-3-2-4-9-13;1-2-5(7)8-4-3-6/h2-6,8-9H,1,7,11H2;2,6H,1,3-4H2 |
| InChIKey | UDTVEOQYVGDLBT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate?
The IUPAC name of benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate (CID 68674346) is benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate.
What is the SMILES notation for benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate?
The canonical SMILES for benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate is C=C(CC=CC#N)C(=O)OCc1ccccc1.C=CC(=O)OCCO.
What is the InChIKey of benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate?
The InChIKey is UDTVEOQYVGDLBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2.C5H8O3/c1-12(7-5-6-10-15)14(16)17-11-13-8-3-2-4-9-13;1-2-5(7)8-4-3-6/h2-6,8-9H,1,7,11H2;2,6H,1,3-4H2.
What are the key properties of benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate?
benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate has a molecular weight of 343.38 g/mol, XLogP of 2.46, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-cyano-2-methylidenepent-4-enoate;2-hydroxyethyl prop-2-enoate is sourced from PubChem (CID 68674346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).