C19H22O7 — CID 175541884
benzene-1,2-diol;2-hydroxyethyl prop-2-enoate;2-phenylacetic acid (PubChem CID 175541884) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is benzene-1,2-diol;2-hydroxyethyl prop-2-enoate;2-phenylacetic acid.
| Compound Name | benzene-1,2-diol;2-hydroxyethyl prop-2-enoate;2-phenylacetic acid |
|---|---|
| PubChem CID | 175541884 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | benzene-1,2-diol;2-hydroxyethyl prop-2-enoate;2-phenylacetic acid |
| SMILES | C=CC(=O)OCCO.O=C(O)Cc1ccccc1.Oc1ccccc1O |
| InChI | InChI=1S/C8H8O2.C6H6O2.C5H8O3/c9-8(10)6-7-4-2-1-3-5-7;7-5-3-1-2-4-6(5)8;1-2-5(7)8-4-3-6/h1-5H,6H2,(H,9,10);1-4,7-8H;2,6H,1,3-4H2 |
| InChIKey | DPUOOCWRJAGOAW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|