C34H43N5O5 — CID 68675078
N-[2-[[2-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-4-pyridinyl]methylamino]ethyl]-2-methoxy-N-methylbenzamide (PubChem CID 68675078) has the molecular formula C34H43N5O5 and a molecular weight of 601.75 g/mol. Its IUPAC name is N-[2-[[2-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-4-pyridinyl]methylamino]ethyl]-2-methoxy-N-methylbenzamide.
| Compound Name | N-[2-[[2-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-4-pyridinyl]methylamino]ethyl]-2-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 68675078 |
| Molecular Formula | C34H43N5O5 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.33 |
| IUPAC Name | N-[2-[[2-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-4-pyridinyl]methylamino]ethyl]-2-methoxy-N-methylbenzamide |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCc3cc(CNCCN(C)C(=O)c4ccccc4OC)ccn3)ccc21 |
| InChI | InChI=1S/C34H43N5O5/c1-7-39-28-15-14-26(22-29(28)38(5)32(41)34(2,3)33(39)42)44-20-10-11-25-21-24(16-17-36-25)23-35-18-19-37(4)31(40)27-12-8-9-13-30(27)43-6/h8-9,12-17,21-22,35H,7,10-11,18-20,23H2,1-6H3 |
| InChIKey | UQXSGCYHMNLNQA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|