C35H41N5O5 — CID 68673747
1-ethyl-7-[3-[[2-[2-(8-methoxyquinolin-2-yl)oxyethyl]-4-pyridinyl]methylamino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 68673747) has the molecular formula C35H41N5O5 and a molecular weight of 611.74 g/mol. Its IUPAC name is 1-ethyl-7-[3-[[2-[2-(8-methoxyquinolin-2-yl)oxyethyl]-4-pyridinyl]methylamino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-7-[3-[[2-[2-(8-methoxyquinolin-2-yl)oxyethyl]-4-pyridinyl]methylamino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68673747 |
| Molecular Formula | C35H41N5O5 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | 1-ethyl-7-[3-[[2-[2-(8-methoxyquinolin-2-yl)oxyethyl]-4-pyridinyl]methylamino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCNCc3ccnc(CCOc4ccc5cccc(OC)c5n4)c3)ccc21 |
| InChI | InChI=1S/C35H41N5O5/c1-6-40-28-13-12-27(22-29(28)39(4)33(41)35(2,3)34(40)42)44-19-8-17-36-23-24-15-18-37-26(21-24)16-20-45-31-14-11-25-9-7-10-30(43-5)32(25)38-31/h7,9-15,18,21-22,36H,6,8,16-17,19-20,23H2,1-5H3 |
| InChIKey | ADMBBSHUFBJLJT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|