C32H37N5O4S — CID 68673355
1-ethyl-3,3,5-trimethyl-7-[3-[[2-[2-(4-oxothieno[3,2-c]pyridin-5-yl)ethyl]-3-pyridinyl]methylamino]propoxy]-1,5-benzodiazepine-2,4-dione (PubChem CID 68673355) has the molecular formula C32H37N5O4S and a molecular weight of 587.75 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[3-[[2-[2-(4-oxothieno[3,2-c]pyridin-5-yl)ethyl]-3-pyridinyl]methylamino]propoxy]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[3-[[2-[2-(4-oxothieno[3,2-c]pyridin-5-yl)ethyl]-3-pyridinyl]methylamino]propoxy]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68673355 |
| Molecular Formula | C32H37N5O4S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[3-[[2-[2-(4-oxothieno[3,2-c]pyridin-5-yl)ethyl]-3-pyridinyl]methylamino]propoxy]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCNCc3cccnc3CCn3ccc4sccc4c3=O)ccc21 |
| InChI | InChI=1S/C32H37N5O4S/c1-5-37-26-10-9-23(20-27(26)35(4)30(39)32(2,3)31(37)40)41-18-7-14-33-21-22-8-6-15-34-25(22)11-16-36-17-12-28-24(29(36)38)13-19-42-28/h6,8-10,12-13,15,17,19-20,33H,5,7,11,14,16,18,21H2,1-4H3 |
| InChIKey | UHESVFHDNLPDRA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|