C24H32N4O2 — CID 70656704
1-ethyl-3,3,5-trimethyl-7-[4-(pyridin-4-ylmethylamino)butyl]-1,5-benzodiazepine-2,4-dione (PubChem CID 70656704) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[4-(pyridin-4-ylmethylamino)butyl]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[4-(pyridin-4-ylmethylamino)butyl]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70656704 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[4-(pyridin-4-ylmethylamino)butyl]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CCCCNCc3ccncc3)ccc21 |
| InChI | InChI=1S/C24H32N4O2/c1-5-28-20-10-9-18(8-6-7-13-26-17-19-11-14-25-15-12-19)16-21(20)27(4)22(29)24(2,3)23(28)30/h9-12,14-16,26H,5-8,13,17H2,1-4H3 |
| InChIKey | GLFPDRRPPCWXME-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|