C21H29N5O2 — CID 70656915
7-[[(1,5-dimethylpyrazol-3-yl)methylamino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 70656915) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 7-[[(1,5-dimethylpyrazol-3-yl)methylamino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[[(1,5-dimethylpyrazol-3-yl)methylamino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70656915 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 7-[[(1,5-dimethylpyrazol-3-yl)methylamino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CNCc3cc(C)n(C)n3)ccc21 |
| InChI | InChI=1S/C21H29N5O2/c1-7-26-17-9-8-15(12-22-13-16-10-14(2)25(6)23-16)11-18(17)24(5)19(27)21(3,4)20(26)28/h8-11,22H,7,12-13H2,1-6H3 |
| InChIKey | RZSYMSJJJDDKKP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|