C25H27FN2O5 — CID 68677321
tert-butyl N-[2-[4-[(1-acetyl-6-fluoro-2-oxoindol-3-ylidene)-methoxymethyl]phenyl]ethyl]carbamate (PubChem CID 68677321) has the molecular formula C25H27FN2O5 and a molecular weight of 454.50 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(1-acetyl-6-fluoro-2-oxoindol-3-ylidene)-methoxymethyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(1-acetyl-6-fluoro-2-oxoindol-3-ylidene)-methoxymethyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 68677321 |
| Molecular Formula | C25H27FN2O5 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | tert-butyl N-[2-[4-[(1-acetyl-6-fluoro-2-oxoindol-3-ylidene)-methoxymethyl]phenyl]ethyl]carbamate |
| SMILES | COC(=C1C(=O)N(C(C)=O)c2cc(F)ccc21)c1ccc(CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H27FN2O5/c1-15(29)28-20-14-18(26)10-11-19(20)21(23(28)30)22(32-5)17-8-6-16(7-9-17)12-13-27-24(31)33-25(2,3)4/h6-11,14H,12-13H2,1-5H3,(H,27,31) |
| InChIKey | ZDPUCPOFIROEBM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|