About 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one
4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one (PubChem CID 68680234) has the molecular formula C19H13BrF4N2O
and a molecular weight of 441.22 g/mol. Its IUPAC name is 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one.
Molecular Properties
| Compound Name | 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one |
| PubChem CID | 68680234 |
| Molecular Formula | C19H13BrF4N2O |
| Molecular Weight | 441.22 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one |
| SMILES | O=c1c(Br)c(C2CC2)n(Cc2ccc(F)cc2F)n1-c1cc(F)ccc1F |
| InChI | InChI=1S/C19H13BrF4N2O/c20-17-18(10-1-2-10)25(9-11-3-4-12(21)7-15(11)24)26(19(17)27)16-8-13(22)5-6-14(16)23/h3-8,10H,1-2,9H2 |
| InChIKey | FFOVPPDHSYPRJJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.22 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one?
The IUPAC name of 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one (CID 68680234) is 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one.
What is the SMILES notation for 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one?
The canonical SMILES for 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one is O=c1c(Br)c(C2CC2)n(Cc2ccc(F)cc2F)n1-c1cc(F)ccc1F.
What is the InChIKey of 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one?
The InChIKey is FFOVPPDHSYPRJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrF4N2O/c20-17-18(10-1-2-10)25(9-11-3-4-12(21)7-15(11)24)26(19(17)27)16-8-13(22)5-6-14(16)23/h3-8,10H,1-2,9H2.
What are the key properties of 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one?
4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one has a molecular weight of 441.22 g/mol, XLogP of 4.88, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-cyclopropyl-2-(2,5-difluorophenyl)-1-[(2,4-difluorophenyl)methyl]pyrazol-3-one is sourced from PubChem (CID 68680234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).