C20H22F2N2O — CID 163680237
(2S,7S)-10-[(2,4-difluorophenyl)methyl]-2,3,3,11-tetramethyl-10,11-diazatetracyclo[6.3.0.02,4.04,7]undec-1(8)-en-9-one (PubChem CID 163680237) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is (2S,7S)-10-[(2,4-difluorophenyl)methyl]-2,3,3,11-tetramethyl-10,11-diazatetracyclo[6.3.0.02,4.04,7]undec-1(8)-en-9-one.
| Compound Name | (2S,7S)-10-[(2,4-difluorophenyl)methyl]-2,3,3,11-tetramethyl-10,11-diazatetracyclo[6.3.0.02,4.04,7]undec-1(8)-en-9-one |
|---|---|
| PubChem CID | 163680237 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2S,7S)-10-[(2,4-difluorophenyl)methyl]-2,3,3,11-tetramethyl-10,11-diazatetracyclo[6.3.0.02,4.04,7]undec-1(8)-en-9-one |
| SMILES | Cn1c2c(c(=O)n1Cc1ccc(F)cc1F)[C@H]1CCC13C(C)(C)[C@]23C |
| InChI | InChI=1S/C20H22F2N2O/c1-18(2)19(3)16-15(13-7-8-20(13,18)19)17(25)24(23(16)4)10-11-5-6-12(21)9-14(11)22/h5-6,9,13H,7-8,10H2,1-4H3/t13-,19+,20?/m1/s1 |
| InChIKey | JKFKEJZPRUCNLP-LZXZIGIKSA-N |
| XLogP | 3.69 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |