C22H32FN7O — CID 68682564
2-[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-4-yl]cyclopentane-1-carboxamide;hydrazine (PubChem CID 68682564) has the molecular formula C22H32FN7O and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-4-yl]cyclopentane-1-carboxamide;hydrazine.
| Compound Name | 2-[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-4-yl]cyclopentane-1-carboxamide;hydrazine |
|---|---|
| PubChem CID | 68682564 |
| Molecular Formula | C22H32FN7O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2-[5-fluoro-2-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-4-yl]cyclopentane-1-carboxamide;hydrazine |
| SMILES | Cc1cc(-c2ncc(F)c(C3CCCC3C(N)=O)n2)ccc1N1CCN(C)CC1.NN |
| InChI | InChI=1S/C22H28FN5O.H4N2/c1-14-12-15(6-7-19(14)28-10-8-27(2)9-11-28)22-25-13-18(23)20(26-22)16-4-3-5-17(16)21(24)29;1-2/h6-7,12-13,16-17H,3-5,8-11H2,1-2H3,(H2,24,29);1-2H2 |
| InChIKey | LKUPOUTXHFHFKG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|