methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate

C10H9F3O2S — CID 68684094

IUPACmethyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate
SMILESCOC(=O)c1cccc(SCC(F)(F)F)c1
InChIInChI=1S/C10H9F3O2S/c1-15-9(14)7-3-2-4-8(5-7)16-6-10(11,12)13/h2-5H,6H2,1H3
InChIKeyZXKJWDVUHMJFIG-UHFFFAOYSA-N
MW250.24 g/mol
LogP3.13
Rot. Bonds3

About methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate

methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate (PubChem CID 68684094) has the molecular formula C10H9F3O2S and a molecular weight of 250.24 g/mol. Its IUPAC name is methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate.

Molecular Properties

Compound Namemethyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate
PubChem CID68684094
Molecular FormulaC10H9F3O2S
Molecular Weight250.24 g/mol
Exact Mass250.03
IUPAC Namemethyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate
SMILESCOC(=O)c1cccc(SCC(F)(F)F)c1
InChIInChI=1S/C10H9F3O2S/c1-15-9(14)7-3-2-4-8(5-7)16-6-10(11,12)13/h2-5H,6H2,1H3
InChIKeyZXKJWDVUHMJFIG-UHFFFAOYSA-N
XLogP3.13
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.24
LogP ≤ 53.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate?
The IUPAC name of methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate (CID 68684094) is methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate.
What is the SMILES notation for methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate?
The canonical SMILES for methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate is COC(=O)c1cccc(SCC(F)(F)F)c1.
What is the InChIKey of methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate?
The InChIKey is ZXKJWDVUHMJFIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3O2S/c1-15-9(14)7-3-2-4-8(5-7)16-6-10(11,12)13/h2-5H,6H2,1H3.
What are the key properties of methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate?
methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate has a molecular weight of 250.24 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,2,2-trifluoroethylsulfanyl)benzoate is sourced from PubChem (CID 68684094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).