C28H35N5O5S — CID 68685905
N-[1-[(3aS,6S,6aS)-6-hydroxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 68685905) has the molecular formula C28H35N5O5S and a molecular weight of 553.69 g/mol. Its IUPAC name is N-[1-[(3aS,6S,6aS)-6-hydroxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[1-[(3aS,6S,6aS)-6-hydroxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 68685905 |
| Molecular Formula | C28H35N5O5S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | N-[1-[(3aS,6S,6aS)-6-hydroxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | CN1CCN(c2nc(-c3ccc(C(=O)NC4(C(=O)N5C[C@H](O)[C@H]6OCC(=O)[C@H]65)CCCCC4)cc3)cs2)CC1 |
| InChI | InChI=1S/C28H35N5O5S/c1-31-11-13-32(14-12-31)27-29-20(17-39-27)18-5-7-19(8-6-18)25(36)30-28(9-3-2-4-10-28)26(37)33-15-21(34)24-23(33)22(35)16-38-24/h5-8,17,21,23-24,34H,2-4,9-16H2,1H3,(H,30,36)/t21-,23+,24+/m0/s1 |
| InChIKey | PRCIHRCUTPYVNF-QPTUXGOLSA-N |
| XLogP | 1.53 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |