C26H36N4O6 — CID 24891317
N-[1-[(3aS,6S,6aS)-6-hydroxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-[4-(2-methoxyethyl)piperazin-1-yl]benzamide (PubChem CID 24891317) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[1-[(3aS,6S,6aS)-6-hydroxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-[4-(2-methoxyethyl)piperazin-1-yl]benzamide.
| Compound Name | N-[1-[(3aS,6S,6aS)-6-hydroxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-[4-(2-methoxyethyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 24891317 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | N-[1-[(3aS,6S,6aS)-6-hydroxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-[4-(2-methoxyethyl)piperazin-1-yl]benzamide |
| SMILES | COCCN1CCN(c2ccc(C(=O)NC3(C(=O)N4C[C@H](O)[C@H]5OCC(=O)[C@H]54)CCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H36N4O6/c1-35-15-14-28-10-12-29(13-11-28)19-6-4-18(5-7-19)24(33)27-26(8-2-3-9-26)25(34)30-16-20(31)23-22(30)21(32)17-36-23/h4-7,20,22-23,31H,2-3,8-17H2,1H3,(H,27,33)/t20-,22+,23+/m0/s1 |
| InChIKey | JLWFYACHAYWIIY-MDNUFGMLSA-N |
| XLogP | 0.04 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |