C28H40N4O4 — CID 143609091
N-[1-[(3aS,6R,6aR)-6-amino-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propylpiperidin-4-yl)benzamide (PubChem CID 143609091) has the molecular formula C28H40N4O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is N-[1-[(3aS,6R,6aR)-6-amino-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propylpiperidin-4-yl)benzamide.
| Compound Name | N-[1-[(3aS,6R,6aR)-6-amino-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 143609091 |
| Molecular Formula | C28H40N4O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | N-[1-[(3aS,6R,6aR)-6-amino-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propylpiperidin-4-yl)benzamide |
| SMILES | CCCN1CCC(c2ccc(C(=O)NC3(C(=O)N4C[C@@H](N)[C@H]5OCC(=O)[C@H]54)CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C28H40N4O4/c1-2-14-31-15-10-20(11-16-31)19-6-8-21(9-7-19)26(34)30-28(12-4-3-5-13-28)27(35)32-17-22(29)25-24(32)23(33)18-36-25/h6-9,20,22,24-25H,2-5,10-18,29H2,1H3,(H,30,34)/t22-,24-,25-/m1/s1 |
| InChIKey | YQOGAEPUORFGSG-QLBJFCOMSA-N |
| XLogP | 2.21 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |