C28H39N3O4 — CID 24891220
N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propan-2-ylpiperidin-4-yl)benzamide (PubChem CID 24891220) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propan-2-ylpiperidin-4-yl)benzamide.
| Compound Name | N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propan-2-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 24891220 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | N-[1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propan-2-ylpiperidin-4-yl)benzamide |
| SMILES | CC(C)N1CCC(c2ccc(C(=O)NC3(C(=O)N4CC[C@H]5OCC(=O)[C@H]54)CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C28H39N3O4/c1-19(2)30-15-10-21(11-16-30)20-6-8-22(9-7-20)26(33)29-28(13-4-3-5-14-28)27(34)31-17-12-24-25(31)23(32)18-35-24/h6-9,19,21,24-25H,3-5,10-18H2,1-2H3,(H,29,33)/t24-,25-/m1/s1 |
| InChIKey | RHTGNZCXVSZFLX-JWQCQUIFSA-N |
| XLogP | 3.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |