C28H38N4O4 — CID 143608946
N-[1-[(3aS,6S,6aR)-6-(methylamino)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(1-cyclopropylpiperidin-4-yl)benzamide (PubChem CID 143608946) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[1-[(3aS,6S,6aR)-6-(methylamino)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(1-cyclopropylpiperidin-4-yl)benzamide.
| Compound Name | N-[1-[(3aS,6S,6aR)-6-(methylamino)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(1-cyclopropylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 143608946 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | N-[1-[(3aS,6S,6aR)-6-(methylamino)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(1-cyclopropylpiperidin-4-yl)benzamide |
| SMILES | CN[C@H]1CN(C(=O)C2(NC(=O)c3ccc(C4CCN(C5CC5)CC4)cc3)CCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C28H38N4O4/c1-29-22-16-32(24-23(33)17-36-25(22)24)27(35)28(12-2-3-13-28)30-26(34)20-6-4-18(5-7-20)19-10-14-31(15-11-19)21-8-9-21/h4-7,19,21-22,24-25,29H,2-3,8-17H2,1H3,(H,30,34)/t22-,24+,25+/m0/s1 |
| InChIKey | BZVJGNGZPKJKAO-ICDZXHCJSA-N |
| XLogP | 1.84 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |