C26H33N7O4 — CID 143609141
N-[1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide (PubChem CID 143609141) has the molecular formula C26H33N7O4 and a molecular weight of 507.60 g/mol. Its IUPAC name is N-[1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide.
| Compound Name | N-[1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 143609141 |
| Molecular Formula | C26H33N7O4 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-[1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
| SMILES | [N-]=[N+]=N[C@H]1CN(C(=O)C2(NC(=O)c3ccc(N4CCN(C5CC5)CC4)cc3)CCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C26H33N7O4/c27-30-29-20-15-33(22-21(34)16-37-23(20)22)25(36)26(9-1-2-10-26)28-24(35)17-3-5-18(6-4-17)31-11-13-32(14-12-31)19-7-8-19/h3-6,19-20,22-23H,1-2,7-16H2,(H,28,35)/t20-,22+,23+/m0/s1 |
| InChIKey | WRPDGAMFSDMTTN-MDNUFGMLSA-N |
| XLogP | 1.87 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|