C29H38N6O4 — CID 143609004
N-[1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-cyclobutylpiperidin-4-yl)benzamide (PubChem CID 143609004) has the molecular formula C29H38N6O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-[1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-cyclobutylpiperidin-4-yl)benzamide.
| Compound Name | N-[1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-cyclobutylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 143609004 |
| Molecular Formula | C29H38N6O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | N-[1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-cyclobutylpiperidin-4-yl)benzamide |
| SMILES | [N-]=[N+]=N[C@H]1CN(C(=O)C2(NC(=O)c3ccc(C4CCN(C5CCC5)CC4)cc3)CCCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C29H38N6O4/c30-33-32-23-17-35(25-24(36)18-39-26(23)25)28(38)29(13-2-1-3-14-29)31-27(37)21-9-7-19(8-10-21)20-11-15-34(16-12-20)22-5-4-6-22/h7-10,20,22-23,25-26H,1-6,11-18H2,(H,31,37)/t23-,25+,26+/m0/s1 |
| InChIKey | YSKXZFQEQHXGDY-SKBVVQJISA-N |
| XLogP | 3.71 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|