C30H43N3O5 — CID 143609055
N-[1-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propan-2-ylpiperidin-4-yl)benzamide (PubChem CID 143609055) has the molecular formula C30H43N3O5 and a molecular weight of 525.69 g/mol. Its IUPAC name is N-[1-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propan-2-ylpiperidin-4-yl)benzamide.
| Compound Name | N-[1-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propan-2-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 143609055 |
| Molecular Formula | C30H43N3O5 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | N-[1-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclohexyl]-4-(1-propan-2-ylpiperidin-4-yl)benzamide |
| SMILES | CCO[C@H]1CN(C(=O)C2(NC(=O)c3ccc(C4CCN(C(C)C)CC4)cc3)CCCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C30H43N3O5/c1-4-37-25-18-33(26-24(34)19-38-27(25)26)29(36)30(14-6-5-7-15-30)31-28(35)23-10-8-21(9-11-23)22-12-16-32(17-13-22)20(2)3/h8-11,20,22,25-27H,4-7,12-19H2,1-3H3,(H,31,35)/t25-,26+,27+/m0/s1 |
| InChIKey | VXYCAYYHOBQKOV-OYUWMTPXSA-N |
| XLogP | 3.29 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |