C28H38N4O5 — CID 24891065
N-[1-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide (PubChem CID 24891065) has the molecular formula C28H38N4O5 and a molecular weight of 510.64 g/mol. Its IUPAC name is N-[1-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide.
| Compound Name | N-[1-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 24891065 |
| Molecular Formula | C28H38N4O5 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | N-[1-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
| SMILES | CCO[C@H]1CN(C(=O)C2(NC(=O)c3ccc(N4CCN(C5CC5)CC4)cc3)CCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C28H38N4O5/c1-2-36-23-17-32(24-22(33)18-37-25(23)24)27(35)28(11-3-4-12-28)29-26(34)19-5-7-20(8-6-19)30-13-15-31(16-14-30)21-9-10-21/h5-8,21,23-25H,2-4,9-18H2,1H3,(H,29,34)/t23-,24+,25+/m0/s1 |
| InChIKey | VCRRVOKJDZKVHJ-ISJGIBHGSA-N |
| XLogP | 1.60 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |