C25H34N4O5 — CID 143609149
N-[1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 143609149) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 143609149 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | N-[1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carbonyl]cyclopentyl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CO[C@@H]1CN(C(=O)C2(NC(=O)c3ccc(N4CCN(C)CC4)cc3)CCCC2)[C@@H]2C(=O)CO[C@@H]21 |
| InChI | InChI=1S/C25H34N4O5/c1-27-11-13-28(14-12-27)18-7-5-17(6-8-18)23(31)26-25(9-3-4-10-25)24(32)29-15-20(33-2)22-21(29)19(30)16-34-22/h5-8,20-22H,3-4,9-16H2,1-2H3,(H,26,31)/t20-,21-,22-/m1/s1 |
| InChIKey | NIYABCBZRCXMEP-YPAWHYETSA-N |
| XLogP | 0.67 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |