C22H21NO4S — CID 68688661
2-[2-[4-(4-methyl-N-sulfinoanilino)phenyl]ethyl]benzoic acid (PubChem CID 68688661) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[2-[4-(4-methyl-N-sulfinoanilino)phenyl]ethyl]benzoic acid.
| Compound Name | 2-[2-[4-(4-methyl-N-sulfinoanilino)phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68688661 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[2-[4-(4-methyl-N-sulfinoanilino)phenyl]ethyl]benzoic acid |
| SMILES | Cc1ccc(N(c2ccc(CCc3ccccc3C(=O)O)cc2)S(=O)O)cc1 |
| InChI | InChI=1S/C22H21NO4S/c1-16-6-12-19(13-7-16)23(28(26)27)20-14-9-17(10-15-20)8-11-18-4-2-3-5-21(18)22(24)25/h2-7,9-10,12-15H,8,11H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | CLABPMAKSCGDNN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|