C28H27NO4S — CID 68690609
2-[5-[2-[naphthalen-2-yl(sulfino)amino]phenyl]pentyl]benzoic acid (PubChem CID 68690609) has the molecular formula C28H27NO4S and a molecular weight of 473.59 g/mol. Its IUPAC name is 2-[5-[2-[naphthalen-2-yl(sulfino)amino]phenyl]pentyl]benzoic acid.
| Compound Name | 2-[5-[2-[naphthalen-2-yl(sulfino)amino]phenyl]pentyl]benzoic acid |
|---|---|
| PubChem CID | 68690609 |
| Molecular Formula | C28H27NO4S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[5-[2-[naphthalen-2-yl(sulfino)amino]phenyl]pentyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCCCCc1ccccc1N(c1ccc2ccccc2c1)S(=O)O |
| InChI | InChI=1S/C28H27NO4S/c30-28(31)26-16-8-6-12-22(26)11-2-1-3-13-23-14-7-9-17-27(23)29(34(32)33)25-19-18-21-10-4-5-15-24(21)20-25/h4-10,12,14-20H,1-3,11,13H2,(H,30,31)(H,32,33) |
| InChIKey | YVCIWVOJQMCWTG-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|