C26H23NO4S — CID 68690626
2-[3-[2-[naphthalen-1-yl(sulfino)amino]phenyl]propyl]benzoic acid (PubChem CID 68690626) has the molecular formula C26H23NO4S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[3-[2-[naphthalen-1-yl(sulfino)amino]phenyl]propyl]benzoic acid.
| Compound Name | 2-[3-[2-[naphthalen-1-yl(sulfino)amino]phenyl]propyl]benzoic acid |
|---|---|
| PubChem CID | 68690626 |
| Molecular Formula | C26H23NO4S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-[3-[2-[naphthalen-1-yl(sulfino)amino]phenyl]propyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCCc1ccccc1N(c1cccc2ccccc12)S(=O)O |
| InChI | InChI=1S/C26H23NO4S/c28-26(29)23-16-5-2-10-20(23)12-7-14-21-11-3-6-17-24(21)27(32(30)31)25-18-8-13-19-9-1-4-15-22(19)25/h1-6,8-11,13,15-18H,7,12,14H2,(H,28,29)(H,30,31) |
| InChIKey | IYDLAMPRENLOHY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|