C21H33N5O6 — CID 68697373
[3-amino-1-[[cyclopropyl(2,2-diethoxyethyl)carbamoyl]-(2-pyridin-3-ylethyl)amino]-1-oxopropan-2-yl]carbamic acid (PubChem CID 68697373) has the molecular formula C21H33N5O6 and a molecular weight of 451.52 g/mol. Its IUPAC name is [3-amino-1-[[cyclopropyl(2,2-diethoxyethyl)carbamoyl]-(2-pyridin-3-ylethyl)amino]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [3-amino-1-[[cyclopropyl(2,2-diethoxyethyl)carbamoyl]-(2-pyridin-3-ylethyl)amino]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68697373 |
| Molecular Formula | C21H33N5O6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | [3-amino-1-[[cyclopropyl(2,2-diethoxyethyl)carbamoyl]-(2-pyridin-3-ylethyl)amino]-1-oxopropan-2-yl]carbamic acid |
| SMILES | CCOC(CN(C(=O)N(CCc1cccnc1)C(=O)C(CN)NC(=O)O)C1CC1)OCC |
| InChI | InChI=1S/C21H33N5O6/c1-3-31-18(32-4-2)14-26(16-7-8-16)21(30)25(11-9-15-6-5-10-23-13-15)19(27)17(12-22)24-20(28)29/h5-6,10,13,16-18,24H,3-4,7-9,11-12,14,22H2,1-2H3,(H,28,29) |
| InChIKey | UQJATRDABFCRLL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|