C19H21F3N2O — CID 68701165
N-[(4-tert-butylphenyl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]acetamide (PubChem CID 68701165) has the molecular formula C19H21F3N2O and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]acetamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 68701165 |
| Molecular Formula | C19H21F3N2O |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]acetamide |
| SMILES | CC(C)(C)c1ccc(CNC(=O)Cc2cccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H21F3N2O/c1-18(2,3)14-9-7-13(8-10-14)12-23-17(25)11-15-5-4-6-16(24-15)19(20,21)22/h4-10H,11-12H2,1-3H3,(H,23,25) |
| InChIKey | GRPNPGKVZJUCJF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |