2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid

C8H8ClF3N2O4 — CID 68703271

IUPAC2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid
SMILESCc1nc(Cl)cn1CC(=O)O.O=C(O)C(F)(F)F
InChIInChI=1S/C6H7ClN2O2.C2HF3O2/c1-4-8-5(7)2-9(4)3-6(10)11;3-2(4,5)1(6)7/h2H,3H2,1H3,(H,10,11);(H,6,7)
InChIKeyFDKQRTYKRMBYMW-UHFFFAOYSA-N
MW288.61 g/mol
LogP1.56
Rot. Bonds2

About 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid

2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 68703271) has the molecular formula C8H8ClF3N2O4 and a molecular weight of 288.61 g/mol. Its IUPAC name is 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid
PubChem CID68703271
Molecular FormulaC8H8ClF3N2O4
Molecular Weight288.61 g/mol
Exact Mass288.01
IUPAC Name2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid
SMILESCc1nc(Cl)cn1CC(=O)O.O=C(O)C(F)(F)F
InChIInChI=1S/C6H7ClN2O2.C2HF3O2/c1-4-8-5(7)2-9(4)3-6(10)11;3-2(4,5)1(6)7/h2H,3H2,1H3,(H,10,11);(H,6,7)
InChIKeyFDKQRTYKRMBYMW-UHFFFAOYSA-N
XLogP1.56
TPSA92.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.61
LogP ≤ 51.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid (CID 68703271) is 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid is Cc1nc(Cl)cn1CC(=O)O.O=C(O)C(F)(F)F.
What is the InChIKey of 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid?
The InChIKey is FDKQRTYKRMBYMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2.C2HF3O2/c1-4-8-5(7)2-9(4)3-6(10)11;3-2(4,5)1(6)7/h2H,3H2,1H3,(H,10,11);(H,6,7).
What are the key properties of 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid?
2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid has a molecular weight of 288.61 g/mol, XLogP of 1.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2-methylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 68703271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).