C20H15F3N2O — CID 68704218
2-methyl-N-quinolin-8-yl-4-(3,3,3-trifluoroprop-1-enyl)benzamide (PubChem CID 68704218) has the molecular formula C20H15F3N2O and a molecular weight of 356.35 g/mol. Its IUPAC name is 2-methyl-N-quinolin-8-yl-4-(3,3,3-trifluoroprop-1-enyl)benzamide.
| Compound Name | 2-methyl-N-quinolin-8-yl-4-(3,3,3-trifluoroprop-1-enyl)benzamide |
|---|---|
| PubChem CID | 68704218 |
| Molecular Formula | C20H15F3N2O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-methyl-N-quinolin-8-yl-4-(3,3,3-trifluoroprop-1-enyl)benzamide |
| SMILES | Cc1cc(C=CC(F)(F)F)ccc1C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H15F3N2O/c1-13-12-14(9-10-20(21,22)23)7-8-16(13)19(26)25-17-6-2-4-15-5-3-11-24-18(15)17/h2-12H,1H3,(H,25,26) |
| InChIKey | OXKBRHNDDFNTPG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |