C11H21N3O2 — CID 68707014
3-(piperazin-1-ylmethyl)piperidine-1-carboxylic acid (PubChem CID 68707014) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-(piperazin-1-ylmethyl)piperidine-1-carboxylic acid.
| Compound Name | 3-(piperazin-1-ylmethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68707014 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 3-(piperazin-1-ylmethyl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC(CN2CCNCC2)C1 |
| InChI | InChI=1S/C11H21N3O2/c15-11(16)14-5-1-2-10(9-14)8-13-6-3-12-4-7-13/h10,12H,1-9H2,(H,15,16) |
| InChIKey | DQDGKHCYBULMGH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |