About 1-(cyclohexylmethyl)piperazine;piperazine
1-(cyclohexylmethyl)piperazine;piperazine (PubChem CID 66986907) has the molecular formula C15H32N4
and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)piperazine;piperazine.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)piperazine;piperazine |
| PubChem CID | 66986907 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 1-(cyclohexylmethyl)piperazine;piperazine |
| SMILES | C1CCC(CN2CCNCC2)CC1.C1CNCCN1 |
| InChI | InChI=1S/C11H22N2.C4H10N2/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;1-2-6-4-3-5-1/h11-12H,1-10H2;5-6H,1-4H2 |
| InChIKey | PTSATLHXZNWTNS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(cyclohexylmethyl)piperazine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)piperazine;piperazine?
The IUPAC name of 1-(cyclohexylmethyl)piperazine;piperazine (CID 66986907) is 1-(cyclohexylmethyl)piperazine;piperazine.
What is the SMILES notation for 1-(cyclohexylmethyl)piperazine;piperazine?
The canonical SMILES for 1-(cyclohexylmethyl)piperazine;piperazine is C1CCC(CN2CCNCC2)CC1.C1CNCCN1.
What is the InChIKey of 1-(cyclohexylmethyl)piperazine;piperazine?
The InChIKey is PTSATLHXZNWTNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.C4H10N2/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;1-2-6-4-3-5-1/h11-12H,1-10H2;5-6H,1-4H2.
What are the key properties of 1-(cyclohexylmethyl)piperazine;piperazine?
1-(cyclohexylmethyl)piperazine;piperazine has a molecular weight of 268.45 g/mol, XLogP of 0.65, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)piperazine;piperazine is sourced from PubChem (CID 66986907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).