C17H20FN3O2S — CID 68711296
4-[3-(2-fluoro-4-methylphenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]but-2-en-1-amine (PubChem CID 68711296) has the molecular formula C17H20FN3O2S and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[3-(2-fluoro-4-methylphenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]but-2-en-1-amine.
| Compound Name | 4-[3-(2-fluoro-4-methylphenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]but-2-en-1-amine |
|---|---|
| PubChem CID | 68711296 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-[3-(2-fluoro-4-methylphenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]but-2-en-1-amine |
| SMILES | Cc1ccc(N2c3ccccc3N(CC=CCN)S2(O)O)c(F)c1 |
| InChI | InChI=1S/C17H20FN3O2S/c1-13-8-9-15(14(18)12-13)21-17-7-3-2-6-16(17)20(24(21,22)23)11-5-4-10-19/h2-9,12,22-23H,10-11,19H2,1H3 |
| InChIKey | FVGTVYQKGNBNBE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|