C13H11FN2S — CID 90985658
3-(2-fluoro-4-methylphenyl)-1H-2,1,3-benzothiadiazole (PubChem CID 90985658) has the molecular formula C13H11FN2S and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(2-fluoro-4-methylphenyl)-1H-2,1,3-benzothiadiazole.
| Compound Name | 3-(2-fluoro-4-methylphenyl)-1H-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 90985658 |
| Molecular Formula | C13H11FN2S |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-(2-fluoro-4-methylphenyl)-1H-2,1,3-benzothiadiazole |
| SMILES | Cc1ccc(N2SNc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C13H11FN2S/c1-9-6-7-12(10(14)8-9)16-13-5-3-2-4-11(13)15-17-16/h2-8,15H,1H3 |
| InChIKey | QXFFKMIHVMVGDW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|