C16H17ClN2O3 — CID 68712146
3-[4-chloro-3-(2,4,5-trimethylpyrazol-3-yl)oxyphenyl]-2-methylprop-2-enoic acid (PubChem CID 68712146) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is 3-[4-chloro-3-(2,4,5-trimethylpyrazol-3-yl)oxyphenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-chloro-3-(2,4,5-trimethylpyrazol-3-yl)oxyphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 68712146 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-[4-chloro-3-(2,4,5-trimethylpyrazol-3-yl)oxyphenyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1ccc(Cl)c(Oc2c(C)c(C)nn2C)c1)C(=O)O |
| InChI | InChI=1S/C16H17ClN2O3/c1-9(16(20)21)7-12-5-6-13(17)14(8-12)22-15-10(2)11(3)18-19(15)4/h5-8H,1-4H3,(H,20,21) |
| InChIKey | WSEUNWBKYYYAFT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|