C17H21FN4O2 — CID 68713158
12-[[(3R,4S)-4-amino-3-hydroxypiperidin-1-yl]methyl]-8-fluoro-1,6-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 68713158) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is 12-[[(3R,4S)-4-amino-3-hydroxypiperidin-1-yl]methyl]-8-fluoro-1,6-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 12-[[(3R,4S)-4-amino-3-hydroxypiperidin-1-yl]methyl]-8-fluoro-1,6-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 68713158 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 12-[[(3R,4S)-4-amino-3-hydroxypiperidin-1-yl]methyl]-8-fluoro-1,6-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | N[C@H]1CCN(CC2CCc3c(F)cnc4ccc(=O)n2c34)C[C@H]1O |
| InChI | InChI=1S/C17H21FN4O2/c18-12-7-20-14-3-4-16(24)22-10(1-2-11(12)17(14)22)8-21-6-5-13(19)15(23)9-21/h3-4,7,10,13,15,23H,1-2,5-6,8-9,19H2/t10?,13-,15+/m0/s1 |
| InChIKey | VVZJHDGIADPDDP-HQPFYNDMSA-N |
| XLogP | 0.42 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |