C16H23Cl2N5O2 — CID 66839850
10-[(4-aminopiperidin-1-yl)methyl]-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-triene-2,8-dione;dihydrochloride (PubChem CID 66839850) has the molecular formula C16H23Cl2N5O2 and a molecular weight of 388.30 g/mol. Its IUPAC name is 10-[(4-aminopiperidin-1-yl)methyl]-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-triene-2,8-dione;dihydrochloride.
| Compound Name | 10-[(4-aminopiperidin-1-yl)methyl]-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-triene-2,8-dione;dihydrochloride |
|---|---|
| PubChem CID | 66839850 |
| Molecular Formula | C16H23Cl2N5O2 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 10-[(4-aminopiperidin-1-yl)methyl]-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-triene-2,8-dione;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(CC2CCn3c(=O)cnc4ccc(=O)n2c43)CC1 |
| InChI | InChI=1S/C16H21N5O2.2ClH/c17-11-3-6-19(7-4-11)10-12-5-8-20-15(23)9-18-13-1-2-14(22)21(12)16(13)20;;/h1-2,9,11-12H,3-8,10,17H2;2*1H |
| InChIKey | IZIIIJWGQVTQTO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |