C12H7ClN2O3S — CID 68714615
5-(6-chlorobenzimidazol-1-yl)-3-hydroxythiophene-2-carboxylic acid (PubChem CID 68714615) has the molecular formula C12H7ClN2O3S and a molecular weight of 294.72 g/mol. Its IUPAC name is 5-(6-chlorobenzimidazol-1-yl)-3-hydroxythiophene-2-carboxylic acid.
| Compound Name | 5-(6-chlorobenzimidazol-1-yl)-3-hydroxythiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68714615 |
| Molecular Formula | C12H7ClN2O3S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 5-(6-chlorobenzimidazol-1-yl)-3-hydroxythiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-n2cnc3ccc(Cl)cc32)cc1O |
| InChI | InChI=1S/C12H7ClN2O3S/c13-6-1-2-7-8(3-6)15(5-14-7)10-4-9(16)11(19-10)12(17)18/h1-5,16H,(H,17,18) |
| InChIKey | IIUXCGQDNWPKQL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|