C13H9ClN2O3S — CID 59855197
methyl 5-(5-chlorobenzimidazol-1-yl)-3-hydroxythiophene-2-carboxylate (PubChem CID 59855197) has the molecular formula C13H9ClN2O3S and a molecular weight of 308.75 g/mol. Its IUPAC name is methyl 5-(5-chlorobenzimidazol-1-yl)-3-hydroxythiophene-2-carboxylate.
| Compound Name | methyl 5-(5-chlorobenzimidazol-1-yl)-3-hydroxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 59855197 |
| Molecular Formula | C13H9ClN2O3S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | methyl 5-(5-chlorobenzimidazol-1-yl)-3-hydroxythiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-n2cnc3cc(Cl)ccc32)cc1O |
| InChI | InChI=1S/C13H9ClN2O3S/c1-19-13(18)12-10(17)5-11(20-12)16-6-15-8-4-7(14)2-3-9(8)16/h2-6,17H,1H3 |
| InChIKey | CWRQJBXUQVBLDL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|