C29H28N2O4SSi — CID 58622920
methyl 5-[5-[tert-butyl(diphenyl)silyl]oxybenzimidazol-1-yl]-3-hydroxythiophene-2-carboxylate (PubChem CID 58622920) has the molecular formula C29H28N2O4SSi and a molecular weight of 528.71 g/mol. Its IUPAC name is methyl 5-[5-[tert-butyl(diphenyl)silyl]oxybenzimidazol-1-yl]-3-hydroxythiophene-2-carboxylate.
| Compound Name | methyl 5-[5-[tert-butyl(diphenyl)silyl]oxybenzimidazol-1-yl]-3-hydroxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 58622920 |
| Molecular Formula | C29H28N2O4SSi |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | methyl 5-[5-[tert-butyl(diphenyl)silyl]oxybenzimidazol-1-yl]-3-hydroxythiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-n2cnc3cc(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)ccc32)cc1O |
| InChI | InChI=1S/C29H28N2O4SSi/c1-29(2,3)37(21-11-7-5-8-12-21,22-13-9-6-10-14-22)35-20-15-16-24-23(17-20)30-19-31(24)26-18-25(32)27(36-26)28(33)34-4/h5-19,32H,1-4H3 |
| InChIKey | NOKLQEURXMWJAV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|