C13H11N3O5S — CID 68839664
5-(5,6-dimethoxyimidazo[4,5-b]pyridin-1-yl)-3-hydroxythiophene-2-carboxylic acid (PubChem CID 68839664) has the molecular formula C13H11N3O5S and a molecular weight of 321.31 g/mol. Its IUPAC name is 5-(5,6-dimethoxyimidazo[4,5-b]pyridin-1-yl)-3-hydroxythiophene-2-carboxylic acid.
| Compound Name | 5-(5,6-dimethoxyimidazo[4,5-b]pyridin-1-yl)-3-hydroxythiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68839664 |
| Molecular Formula | C13H11N3O5S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 5-(5,6-dimethoxyimidazo[4,5-b]pyridin-1-yl)-3-hydroxythiophene-2-carboxylic acid |
| SMILES | COc1cc2c(ncn2-c2cc(O)c(C(=O)O)s2)nc1OC |
| InChI | InChI=1S/C13H11N3O5S/c1-20-8-3-6-11(15-12(8)21-2)14-5-16(6)9-4-7(17)10(22-9)13(18)19/h3-5,17H,1-2H3,(H,18,19) |
| InChIKey | ISPOYDYWLLRIGG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|