About 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid
2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 23654018) has the molecular formula C19H15N3O5S
and a molecular weight of 397.41 g/mol. Its IUPAC name is 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 23654018 |
| Molecular Formula | C19H15N3O5S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1cc2ncn(-c3nc(-c4ccccc4O)c(C(=O)O)s3)c2cc1OC |
| InChI | InChI=1S/C19H15N3O5S/c1-26-14-7-11-12(8-15(14)27-2)22(9-20-11)19-21-16(17(28-19)18(24)25)10-5-3-4-6-13(10)23/h3-9,23H,1-2H3,(H,24,25) |
| InChIKey | UHGNRWHLJFLJGB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid (CID 23654018) is 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid is COc1cc2ncn(-c3nc(-c4ccccc4O)c(C(=O)O)s3)c2cc1OC.
What is the InChIKey of 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is UHGNRWHLJFLJGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O5S/c1-26-14-7-11-12(8-15(14)27-2)22(9-20-11)19-21-16(17(28-19)18(24)25)10-5-3-4-6-13(10)23/h3-9,23H,1-2H3,(H,24,25).
What are the key properties of 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid?
2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 397.41 g/mol, XLogP of 3.57, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethoxybenzimidazol-1-yl)-4-(2-hydroxyphenyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 23654018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).