About 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid
4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 23654019) has the molecular formula C19H14ClN3O4S
and a molecular weight of 415.86 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 23654019 |
| Molecular Formula | C19H14ClN3O4S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1cc2ncn(-c3nc(-c4cccc(Cl)c4)c(C(=O)O)s3)c2cc1OC |
| InChI | InChI=1S/C19H14ClN3O4S/c1-26-14-7-12-13(8-15(14)27-2)23(9-21-12)19-22-16(17(28-19)18(24)25)10-4-3-5-11(20)6-10/h3-9H,1-2H3,(H,24,25) |
| InChIKey | ASNYTHITDPHAHV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid (CID 23654019) is 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid is COc1cc2ncn(-c3nc(-c4cccc(Cl)c4)c(C(=O)O)s3)c2cc1OC.
What is the InChIKey of 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is ASNYTHITDPHAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN3O4S/c1-26-14-7-12-13(8-15(14)27-2)23(9-21-12)19-22-16(17(28-19)18(24)25)10-4-3-5-11(20)6-10/h3-9H,1-2H3,(H,24,25).
What are the key properties of 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid?
4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 415.86 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 23654019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).