C18H13ClN4O4S — CID 23654382
4-(2-chloro-4-pyridinyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 23654382) has the molecular formula C18H13ClN4O4S and a molecular weight of 416.85 g/mol. Its IUPAC name is 4-(2-chloro-4-pyridinyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-(2-chloro-4-pyridinyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23654382 |
| Molecular Formula | C18H13ClN4O4S |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 4-(2-chloro-4-pyridinyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1cc2ncn(-c3nc(-c4ccnc(Cl)c4)c(C(=O)O)s3)c2cc1OC |
| InChI | InChI=1S/C18H13ClN4O4S/c1-26-12-6-10-11(7-13(12)27-2)23(8-21-10)18-22-15(16(28-18)17(24)25)9-3-4-20-14(19)5-9/h3-8H,1-2H3,(H,24,25) |
| InChIKey | RJXKNTHXJWTEPR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|