C19H15Cl2N3O4S — CID 71024111
[4-(3,5-dichlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazol-5-yl]oxymethanol (PubChem CID 71024111) has the molecular formula C19H15Cl2N3O4S and a molecular weight of 452.32 g/mol. Its IUPAC name is [4-(3,5-dichlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazol-5-yl]oxymethanol.
| Compound Name | [4-(3,5-dichlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazol-5-yl]oxymethanol |
|---|---|
| PubChem CID | 71024111 |
| Molecular Formula | C19H15Cl2N3O4S |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | [4-(3,5-dichlorophenyl)-2-(5,6-dimethoxybenzimidazol-1-yl)-1,3-thiazol-5-yl]oxymethanol |
| SMILES | COc1cc2ncn(-c3nc(-c4cc(Cl)cc(Cl)c4)c(OCO)s3)c2cc1OC |
| InChI | InChI=1S/C19H15Cl2N3O4S/c1-26-15-6-13-14(7-16(15)27-2)24(8-22-13)19-23-17(18(29-19)28-9-25)10-3-11(20)5-12(21)4-10/h3-8,25H,9H2,1-2H3 |
| InChIKey | YOTHIHUOGZFAMX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|