C26H29NO6 — CID 68715090
3-O-benzyl 2-O-tert-butyl (3S)-7-(3-methoxy-3-oxoprop-1-enyl)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 68715090) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is 3-O-benzyl 2-O-tert-butyl (3S)-7-(3-methoxy-3-oxoprop-1-enyl)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-benzyl 2-O-tert-butyl (3S)-7-(3-methoxy-3-oxoprop-1-enyl)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 68715090 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 3-O-benzyl 2-O-tert-butyl (3S)-7-(3-methoxy-3-oxoprop-1-enyl)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | COC(=O)C=Cc1ccc2c(c1)CN(C(=O)OC(C)(C)C)[C@H](C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C26H29NO6/c1-26(2,3)33-25(30)27-16-21-14-18(11-13-23(28)31-4)10-12-20(21)15-22(27)24(29)32-17-19-8-6-5-7-9-19/h5-14,22H,15-17H2,1-4H3/t22-/m0/s1 |
| InChIKey | PBEVOWUOJJSHFP-QFIPXVFZSA-N |
| XLogP | 4.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|