C17H17F2N3OS — CID 68716231
4-(difluoromethyl)-2-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 68716231) has the molecular formula C17H17F2N3OS and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-(difluoromethyl)-2-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 68716231 |
| Molecular Formula | C17H17F2N3OS |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-(difluoromethyl)-2-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(F)F)c(C(=O)NCCc2c(C)[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C17H17F2N3OS/c1-9-11(12-5-3-4-6-13(12)21-9)7-8-20-17(23)15-14(16(18)19)22-10(2)24-15/h3-6,16,21H,7-8H2,1-2H3,(H,20,23) |
| InChIKey | DCJIDQXWOGRYPK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|