C37H41N5O5 — CID 68717431
[1-[3-(N-[3-[(2-hydroxyphenyl)methylamino]propanoylamino]anilino)-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 68717431) has the molecular formula C37H41N5O5 and a molecular weight of 635.77 g/mol. Its IUPAC name is [1-[3-(N-[3-[(2-hydroxyphenyl)methylamino]propanoylamino]anilino)-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[3-(N-[3-[(2-hydroxyphenyl)methylamino]propanoylamino]anilino)-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 68717431 |
| Molecular Formula | C37H41N5O5 |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | [1-[3-(N-[3-[(2-hydroxyphenyl)methylamino]propanoylamino]anilino)-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=C(CCNCc1ccccc1O)NN(C(=O)CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C37H41N5O5/c43-34-18-10-7-13-29(34)27-38-23-19-35(44)40-42(30-14-5-2-6-15-30)36(45)22-26-41-24-20-31(21-25-41)47-37(46)39-33-17-9-8-16-32(33)28-11-3-1-4-12-28/h1-18,31,38,43H,19-27H2,(H,39,46)(H,40,44) |
| InChIKey | UTUUZOYPDMTBCZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|