C14H13Cl2N3O — CID 68718360
2,4-bis(chloromethyl)-6-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3,5-triazine (PubChem CID 68718360) has the molecular formula C14H13Cl2N3O and a molecular weight of 310.18 g/mol. Its IUPAC name is 2,4-bis(chloromethyl)-6-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(chloromethyl)-6-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 68718360 |
| Molecular Formula | C14H13Cl2N3O |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2,4-bis(chloromethyl)-6-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3,5-triazine |
| SMILES | COc1ccc(/C=C/c2nc(CCl)nc(CCl)n2)cc1 |
| InChI | InChI=1S/C14H13Cl2N3O/c1-20-11-5-2-10(3-6-11)4-7-12-17-13(8-15)19-14(9-16)18-12/h2-7H,8-9H2,1H3/b7-4+ |
| InChIKey | VOBCXTMFMPYERE-QPJJXVBHSA-N |
| XLogP | 3.53 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|