C13H9AsCl3N3O — CID 87977007
CID 87977007 (PubChem CID 87977007) has the molecular formula C13H9AsCl3N3O and a molecular weight of 404.52 g/mol.
| Compound Name | CID 87977007 |
|---|---|
| PubChem CID | 87977007 |
| Molecular Formula | C13H9AsCl3N3O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | — |
| SMILES | COc1ccc(/C=C/c2nc([As])nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C13H9AsCl3N3O/c1-21-9-5-2-8(3-6-9)4-7-10-18-11(13(15,16)17)20-12(14)19-10/h2-7H,1H3/b7-4+ |
| InChIKey | LTVTYVKMDRULDN-QPJJXVBHSA-N |
| XLogP | 2.67 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|