C16H13Cl6N3O2 — CID 154131642
3-[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]phenoxy]propan-1-ol (PubChem CID 154131642) has the molecular formula C16H13Cl6N3O2 and a molecular weight of 492.02 g/mol. Its IUPAC name is 3-[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]phenoxy]propan-1-ol.
| Compound Name | 3-[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 154131642 |
| Molecular Formula | C16H13Cl6N3O2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 488.91 |
| IUPAC Name | 3-[4-[2-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]ethenyl]phenoxy]propan-1-ol |
| SMILES | OCCCOc1ccc(C=Cc2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C16H13Cl6N3O2/c17-15(18,19)13-23-12(24-14(25-13)16(20,21)22)7-4-10-2-5-11(6-3-10)27-9-1-8-26/h2-7,26H,1,8-9H2 |
| InChIKey | SFGRICDSJJIUQY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|